C8H12N4O2 — CID 55269278
2-amino-5-(1,2-diaminoethyl)pyridine-4-carboxylic acid (PubChem CID 55269278) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-amino-5-(1,2-diaminoethyl)pyridine-4-carboxylic acid.
| Compound Name | 2-amino-5-(1,2-diaminoethyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 55269278 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-amino-5-(1,2-diaminoethyl)pyridine-4-carboxylic acid |
| SMILES | NCC(N)c1cnc(N)cc1C(=O)O |
| InChI | InChI=1S/C8H12N4O2/c9-2-6(10)5-3-12-7(11)1-4(5)8(13)14/h1,3,6H,2,9-10H2,(H2,11,12)(H,13,14) |
| InChIKey | QDHRHIUXVMNDKW-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |