C10H15N3O4S — CID 114195177
2-amino-5-(1-methylsulfonylpropan-2-ylamino)pyridine-4-carboxylic acid (PubChem CID 114195177) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-amino-5-(1-methylsulfonylpropan-2-ylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-amino-5-(1-methylsulfonylpropan-2-ylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114195177 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-amino-5-(1-methylsulfonylpropan-2-ylamino)pyridine-4-carboxylic acid |
| SMILES | CC(CS(C)(=O)=O)Nc1cnc(N)cc1C(=O)O |
| InChI | InChI=1S/C10H15N3O4S/c1-6(5-18(2,16)17)13-8-4-12-9(11)3-7(8)10(14)15/h3-4,6,13H,5H2,1-2H3,(H2,11,12)(H,14,15) |
| InChIKey | LRWZAWMGYFUZLG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |