C12H19N3O3S — CID 64630405
4-amino-N-methyl-2-(1-methylsulfonylpropan-2-ylamino)benzamide (PubChem CID 64630405) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-amino-N-methyl-2-(1-methylsulfonylpropan-2-ylamino)benzamide.
| Compound Name | 4-amino-N-methyl-2-(1-methylsulfonylpropan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 64630405 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-amino-N-methyl-2-(1-methylsulfonylpropan-2-ylamino)benzamide |
| SMILES | CNC(=O)c1ccc(N)cc1NC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C12H19N3O3S/c1-8(7-19(3,17)18)15-11-6-9(13)4-5-10(11)12(16)14-2/h4-6,8,15H,7,13H2,1-3H3,(H,14,16) |
| InChIKey | RTXZLHSUYCSSRG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|