C12H18N4O3 — CID 114194951
2-amino-5-[[1-oxo-1-(propylamino)propan-2-yl]amino]pyridine-4-carboxylic acid (PubChem CID 114194951) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-amino-5-[[1-oxo-1-(propylamino)propan-2-yl]amino]pyridine-4-carboxylic acid.
| Compound Name | 2-amino-5-[[1-oxo-1-(propylamino)propan-2-yl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114194951 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-amino-5-[[1-oxo-1-(propylamino)propan-2-yl]amino]pyridine-4-carboxylic acid |
| SMILES | CCCNC(=O)C(C)Nc1cnc(N)cc1C(=O)O |
| InChI | InChI=1S/C12H18N4O3/c1-3-4-14-11(17)7(2)16-9-6-15-10(13)5-8(9)12(18)19/h5-7,16H,3-4H2,1-2H3,(H2,13,15)(H,14,17)(H,18,19) |
| InChIKey | XMNFHATYOYRGAA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |