C15H23N3O3 — CID 82776751
ethyl 4-amino-3-[[1-oxo-1-(propylamino)propan-2-yl]amino]benzoate (PubChem CID 82776751) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is ethyl 4-amino-3-[[1-oxo-1-(propylamino)propan-2-yl]amino]benzoate.
| Compound Name | ethyl 4-amino-3-[[1-oxo-1-(propylamino)propan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 82776751 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | ethyl 4-amino-3-[[1-oxo-1-(propylamino)propan-2-yl]amino]benzoate |
| SMILES | CCCNC(=O)C(C)Nc1cc(C(=O)OCC)ccc1N |
| InChI | InChI=1S/C15H23N3O3/c1-4-8-17-14(19)10(3)18-13-9-11(6-7-12(13)16)15(20)21-5-2/h6-7,9-10,18H,4-5,8,16H2,1-3H3,(H,17,19) |
| InChIKey | PAQASYOWHQHGPQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|