C14H22N4O2 — CID 63360672
4-amino-3-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-N,N-dimethylbenzamide (PubChem CID 63360672) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-amino-3-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63360672 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-amino-3-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-N,N-dimethylbenzamide |
| SMILES | CCNC(=O)C(C)Nc1cc(C(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C14H22N4O2/c1-5-16-13(19)9(2)17-12-8-10(6-7-11(12)15)14(20)18(3)4/h6-9,17H,5,15H2,1-4H3,(H,16,19) |
| InChIKey | LNIDFFSWQZDTPZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|