C16H22N6O2 — CID 114199928
tert-butyl N-[4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]carbamate (PubChem CID 114199928) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 114199928 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl N-[4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N)c(N2CCn3cnnc3C2)c1 |
| InChI | InChI=1S/C16H22N6O2/c1-16(2,3)24-15(23)19-11-4-5-12(17)13(8-11)21-6-7-22-10-18-20-14(22)9-21/h4-5,8,10H,6-7,9,17H2,1-3H3,(H,19,23) |
| InChIKey | XZFLBZLDZHKYEE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|