C24H29N3O5S — CID 11420042
4-[2-(2-hydroxyethylamino)ethoxy]-N-[4-(2-methoxy-5-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 11420042) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethylamino)ethoxy]-N-[4-(2-methoxy-5-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[2-(2-hydroxyethylamino)ethoxy]-N-[4-(2-methoxy-5-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 11420042 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[2-(2-hydroxyethylamino)ethoxy]-N-[4-(2-methoxy-5-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCOc1ccc(OC)c(-c2csc(NC(=O)c3ccc(OCCNCCO)cc3)n2)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-3-13-31-19-8-9-22(30-2)20(15-19)21-16-33-24(26-21)27-23(29)17-4-6-18(7-5-17)32-14-11-25-10-12-28/h4-9,15-16,25,28H,3,10-14H2,1-2H3,(H,26,27,29) |
| InChIKey | CCPWHDNOBQGTNX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|