About 2-(diethylamino)-2,5,7-trimethyloctan-3-ol
2-(diethylamino)-2,5,7-trimethyloctan-3-ol (PubChem CID 114200733) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is 2-(diethylamino)-2,5,7-trimethyloctan-3-ol.
Molecular Properties
| Compound Name | 2-(diethylamino)-2,5,7-trimethyloctan-3-ol |
| PubChem CID | 114200733 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 2-(diethylamino)-2,5,7-trimethyloctan-3-ol |
| SMILES | CCN(CC)C(C)(C)C(O)CC(C)CC(C)C |
| InChI | InChI=1S/C15H33NO/c1-8-16(9-2)15(6,7)14(17)11-13(5)10-12(3)4/h12-14,17H,8-11H2,1-7H3 |
| InChIKey | SGQKDGUUSQJGQE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)-2,5,7-trimethyloctan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-2,5,7-trimethyloctan-3-ol?
The IUPAC name of 2-(diethylamino)-2,5,7-trimethyloctan-3-ol (CID 114200733) is 2-(diethylamino)-2,5,7-trimethyloctan-3-ol.
What is the SMILES notation for 2-(diethylamino)-2,5,7-trimethyloctan-3-ol?
The canonical SMILES for 2-(diethylamino)-2,5,7-trimethyloctan-3-ol is CCN(CC)C(C)(C)C(O)CC(C)CC(C)C.
What is the InChIKey of 2-(diethylamino)-2,5,7-trimethyloctan-3-ol?
The InChIKey is SGQKDGUUSQJGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO/c1-8-16(9-2)15(6,7)14(17)11-13(5)10-12(3)4/h12-14,17H,8-11H2,1-7H3.
What are the key properties of 2-(diethylamino)-2,5,7-trimethyloctan-3-ol?
2-(diethylamino)-2,5,7-trimethyloctan-3-ol has a molecular weight of 243.43 g/mol, XLogP of 3.54, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-2,5,7-trimethyloctan-3-ol is sourced from PubChem (CID 114200733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).