C27H27FN2O5 — CID 11420189
benzyl N-[2-[[2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]amino]-2-oxoethyl]carbamate (PubChem CID 11420189) has the molecular formula C27H27FN2O5 and a molecular weight of 478.52 g/mol. Its IUPAC name is benzyl N-[2-[[2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 11420189 |
| Molecular Formula | C27H27FN2O5 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | benzyl N-[2-[[2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]amino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NC(Cc1cc(F)cc(OCc2ccccc2)c1)C1CO1 |
| InChI | InChI=1S/C27H27FN2O5/c28-22-11-21(12-23(14-22)33-16-19-7-3-1-4-8-19)13-24(25-18-34-25)30-26(31)15-29-27(32)35-17-20-9-5-2-6-10-20/h1-12,14,24-25H,13,15-18H2,(H,29,32)(H,30,31) |
| InChIKey | HTAANHIFWXOHMN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|