C12H14N4O2 — CID 114203722
ethyl 1-[(5-methylpyrazin-2-yl)methyl]imidazole-4-carboxylate (PubChem CID 114203722) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 1-[(5-methylpyrazin-2-yl)methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-[(5-methylpyrazin-2-yl)methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 114203722 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethyl 1-[(5-methylpyrazin-2-yl)methyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2cnc(C)cn2)cn1 |
| InChI | InChI=1S/C12H14N4O2/c1-3-18-12(17)11-7-16(8-15-11)6-10-5-13-9(2)4-14-10/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | ACOZRSFEOZVLIX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |