C11H19N5O — CID 114207014
5-amino-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidin-6-one (PubChem CID 114207014) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-amino-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114207014 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 5-amino-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CN1CCCN(C)C(c2ncc(N)c(=O)[nH]2)C1 |
| InChI | InChI=1S/C11H19N5O/c1-15-4-3-5-16(2)9(7-15)10-13-6-8(12)11(17)14-10/h6,9H,3-5,7,12H2,1-2H3,(H,13,14,17) |
| InChIKey | FBPLASDFQBDRDB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |