C9H14N4O — CID 154212444
4,6,7,8,9,10-hexahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 154212444) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4,6,7,8,9,10-hexahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | 4,6,7,8,9,10-hexahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 154212444 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4,6,7,8,9,10-hexahydropyrimido[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | NC(=O)C1=CCN2CCNCCC2=N1 |
| InChI | InChI=1S/C9H14N4O/c10-9(14)7-2-5-13-6-4-11-3-1-8(13)12-7/h2,11H,1,3-6H2,(H2,10,14) |
| InChIKey | UFBGFYWCJZXOEE-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |