C10H15N3O — CID 67377057
4,6,7,8,9,10-hexahydropyrimido[1,2-a]azepine-2-carboxamide (PubChem CID 67377057) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4,6,7,8,9,10-hexahydropyrimido[1,2-a]azepine-2-carboxamide.
| Compound Name | 4,6,7,8,9,10-hexahydropyrimido[1,2-a]azepine-2-carboxamide |
|---|---|
| PubChem CID | 67377057 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4,6,7,8,9,10-hexahydropyrimido[1,2-a]azepine-2-carboxamide |
| SMILES | NC(=O)C1=CCN2CCCCCC2=N1 |
| InChI | InChI=1S/C10H15N3O/c11-10(14)8-5-7-13-6-3-1-2-4-9(13)12-8/h5H,1-4,6-7H2,(H2,11,14) |
| InChIKey | ZVVLQJWIZUHFGY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |