About 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate
2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate (PubChem CID 114208675) has the molecular formula C12H15BrN2O4
and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate |
| PubChem CID | 114208675 |
| Molecular Formula | C12H15BrN2O4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate |
| SMILES | CCC(CC)COC(=O)c1cc([N+](=O)[O-])ncc1Br |
| InChI | InChI=1S/C12H15BrN2O4/c1-3-8(4-2)7-19-12(16)9-5-11(15(17)18)14-6-10(9)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | NQCOTIHQCLMWDF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate?
The IUPAC name of 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate (CID 114208675) is 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate.
What is the SMILES notation for 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate?
The canonical SMILES for 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate is CCC(CC)COC(=O)c1cc([N+](=O)[O-])ncc1Br.
What is the InChIKey of 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate?
The InChIKey is NQCOTIHQCLMWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O4/c1-3-8(4-2)7-19-12(16)9-5-11(15(17)18)14-6-10(9)13/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate?
2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate has a molecular weight of 331.17 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutyl 5-bromo-2-nitropyridine-4-carboxylate is sourced from PubChem (CID 114208675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).