About 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate
2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate (PubChem CID 114195815) has the molecular formula C12H17BrN2O2
and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate |
| PubChem CID | 114195815 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate |
| SMILES | CCCC(C)COC(=O)c1cc(N)ncc1Br |
| InChI | InChI=1S/C12H17BrN2O2/c1-3-4-8(2)7-17-12(16)9-5-11(14)15-6-10(9)13/h5-6,8H,3-4,7H2,1-2H3,(H2,14,15) |
| InChIKey | MQHOBXIHGYDCEK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate?
The IUPAC name of 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate (CID 114195815) is 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate.
What is the SMILES notation for 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate?
The canonical SMILES for 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate is CCCC(C)COC(=O)c1cc(N)ncc1Br.
What is the InChIKey of 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate?
The InChIKey is MQHOBXIHGYDCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O2/c1-3-4-8(2)7-17-12(16)9-5-11(14)15-6-10(9)13/h5-6,8H,3-4,7H2,1-2H3,(H2,14,15).
What are the key properties of 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate?
2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate has a molecular weight of 301.18 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 2-amino-5-bromopyridine-4-carboxylate is sourced from PubChem (CID 114195815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).