C13H16Br2ClN — CID 114208972
2,6-dibromo-4-chloro-N-(2-ethylcyclopentyl)aniline (PubChem CID 114208972) has the molecular formula C13H16Br2ClN and a molecular weight of 381.54 g/mol. Its IUPAC name is 2,6-dibromo-4-chloro-N-(2-ethylcyclopentyl)aniline.
| Compound Name | 2,6-dibromo-4-chloro-N-(2-ethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 114208972 |
| Molecular Formula | C13H16Br2ClN |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 2,6-dibromo-4-chloro-N-(2-ethylcyclopentyl)aniline |
| SMILES | CCC1CCCC1Nc1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C13H16Br2ClN/c1-2-8-4-3-5-12(8)17-13-10(14)6-9(16)7-11(13)15/h6-8,12,17H,2-5H2,1H3 |
| InChIKey | XSNNFLAXWULQBT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |