C28H21ClN3OPS — CID 11420921
(5Z)-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-3-[(triphenyl-λ5-phosphanylidene)amino]imidazolidin-4-one (PubChem CID 11420921) has the molecular formula C28H21ClN3OPS and a molecular weight of 513.99 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-3-[(triphenyl-λ5-phosphanylidene)amino]imidazolidin-4-one.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-3-[(triphenyl-λ5-phosphanylidene)amino]imidazolidin-4-one |
|---|---|
| PubChem CID | 11420921 |
| Molecular Formula | C28H21ClN3OPS |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-2-sulfanylidene-3-[(triphenyl-λ5-phosphanylidene)amino]imidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)NC(=S)N1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21ClN3OPS/c29-22-18-16-21(17-19-22)20-26-27(33)32(28(35)30-26)31-34(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-20H,(H,30,35)/b26-20- |
| InChIKey | SHUROPVOCISBGP-QOMWVZHYSA-N |
| XLogP | 5.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|