C16H25FO — CID 114209768
3-(2-fluorophenyl)-7,7-dimethyloctan-3-ol (PubChem CID 114209768) has the molecular formula C16H25FO and a molecular weight of 252.37 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-7,7-dimethyloctan-3-ol.
| Compound Name | 3-(2-fluorophenyl)-7,7-dimethyloctan-3-ol |
|---|---|
| PubChem CID | 114209768 |
| Molecular Formula | C16H25FO |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3-(2-fluorophenyl)-7,7-dimethyloctan-3-ol |
| SMILES | CCC(O)(CCCC(C)(C)C)c1ccccc1F |
| InChI | InChI=1S/C16H25FO/c1-5-16(18,12-8-11-15(2,3)4)13-9-6-7-10-14(13)17/h6-7,9-10,18H,5,8,11-12H2,1-4H3 |
| InChIKey | HRPJVNCTEYYXRN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |