C13H21NO4 — CID 114210362
2-[[(1-hydroxy-4-methoxybutan-2-yl)amino]methyl]-4-methoxyphenol (PubChem CID 114210362) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[[(1-hydroxy-4-methoxybutan-2-yl)amino]methyl]-4-methoxyphenol.
| Compound Name | 2-[[(1-hydroxy-4-methoxybutan-2-yl)amino]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 114210362 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[[(1-hydroxy-4-methoxybutan-2-yl)amino]methyl]-4-methoxyphenol |
| SMILES | COCCC(CO)NCc1cc(OC)ccc1O |
| InChI | InChI=1S/C13H21NO4/c1-17-6-5-11(9-15)14-8-10-7-12(18-2)3-4-13(10)16/h3-4,7,11,14-16H,5-6,8-9H2,1-2H3 |
| InChIKey | XARLNPJTIGFREO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|