C11H17NO4 — CID 65310161
2-[(2-hydroxy-5-methoxyphenyl)methylamino]propane-1,3-diol (PubChem CID 65310161) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-methoxyphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(2-hydroxy-5-methoxyphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65310161 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[(2-hydroxy-5-methoxyphenyl)methylamino]propane-1,3-diol |
| SMILES | COc1ccc(O)c(CNC(CO)CO)c1 |
| InChI | InChI=1S/C11H17NO4/c1-16-10-2-3-11(15)8(4-10)5-12-9(6-13)7-14/h2-4,9,12-15H,5-7H2,1H3 |
| InChIKey | LZHISHBTCOEWCK-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|