C16H21IN2 — CID 114210627
1-(4,4-dimethylpentyl)-2-(3-iodophenyl)imidazole (PubChem CID 114210627) has the molecular formula C16H21IN2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-2-(3-iodophenyl)imidazole.
| Compound Name | 1-(4,4-dimethylpentyl)-2-(3-iodophenyl)imidazole |
|---|---|
| PubChem CID | 114210627 |
| Molecular Formula | C16H21IN2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-2-(3-iodophenyl)imidazole |
| SMILES | CC(C)(C)CCCn1ccnc1-c1cccc(I)c1 |
| InChI | InChI=1S/C16H21IN2/c1-16(2,3)8-5-10-19-11-9-18-15(19)13-6-4-7-14(17)12-13/h4,6-7,9,11-12H,5,8,10H2,1-3H3 |
| InChIKey | QYLYZHVLBRPEGY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|