C13H12F3IN2 — CID 113327565
2-(4-iodophenyl)-1-(4,4,4-trifluorobutyl)imidazole (PubChem CID 113327565) has the molecular formula C13H12F3IN2 and a molecular weight of 380.15 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(4,4,4-trifluorobutyl)imidazole.
| Compound Name | 2-(4-iodophenyl)-1-(4,4,4-trifluorobutyl)imidazole |
|---|---|
| PubChem CID | 113327565 |
| Molecular Formula | C13H12F3IN2 |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 2-(4-iodophenyl)-1-(4,4,4-trifluorobutyl)imidazole |
| SMILES | FC(F)(F)CCCn1ccnc1-c1ccc(I)cc1 |
| InChI | InChI=1S/C13H12F3IN2/c14-13(15,16)6-1-8-19-9-7-18-12(19)10-2-4-11(17)5-3-10/h2-5,7,9H,1,6,8H2 |
| InChIKey | UUTIYTGNLYNXKQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|