C12H16BrNO4 — CID 114211390
(E)-3-(5-bromofuran-2-yl)-N-(1-hydroxy-4-methoxybutan-2-yl)prop-2-enamide (PubChem CID 114211390) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-(1-hydroxy-4-methoxybutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-(1-hydroxy-4-methoxybutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 114211390 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-(1-hydroxy-4-methoxybutan-2-yl)prop-2-enamide |
| SMILES | COCCC(CO)NC(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C12H16BrNO4/c1-17-7-6-9(8-15)14-12(16)5-3-10-2-4-11(13)18-10/h2-5,9,15H,6-8H2,1H3,(H,14,16)/b5-3+ |
| InChIKey | WAKQGOSIGKGDFH-HWKANZROSA-N |
| XLogP | 1.57 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|