C16H25ClO — CID 114211874
1-(1-chloro-4,4-dimethylpentyl)-2-methoxy-3,4-dimethylbenzene (PubChem CID 114211874) has the molecular formula C16H25ClO and a molecular weight of 268.83 g/mol. Its IUPAC name is 1-(1-chloro-4,4-dimethylpentyl)-2-methoxy-3,4-dimethylbenzene.
| Compound Name | 1-(1-chloro-4,4-dimethylpentyl)-2-methoxy-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 114211874 |
| Molecular Formula | C16H25ClO |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(1-chloro-4,4-dimethylpentyl)-2-methoxy-3,4-dimethylbenzene |
| SMILES | COc1c(C(Cl)CCC(C)(C)C)ccc(C)c1C |
| InChI | InChI=1S/C16H25ClO/c1-11-7-8-13(15(18-6)12(11)2)14(17)9-10-16(3,4)5/h7-8,14H,9-10H2,1-6H3 |
| InChIKey | JCVYUCUHYPBVRQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|