C11H12Br2N4 — CID 114213442
(3,5-dibromophenyl)-(3-ethyltriazol-4-yl)methanamine (PubChem CID 114213442) has the molecular formula C11H12Br2N4 and a molecular weight of 360.05 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(3-ethyltriazol-4-yl)methanamine.
| Compound Name | (3,5-dibromophenyl)-(3-ethyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114213442 |
| Molecular Formula | C11H12Br2N4 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | (3,5-dibromophenyl)-(3-ethyltriazol-4-yl)methanamine |
| SMILES | CCn1nncc1C(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H12Br2N4/c1-2-17-10(6-15-16-17)11(14)7-3-8(12)5-9(13)4-7/h3-6,11H,2,14H2,1H3 |
| InChIKey | LXJWFCVZEJQBEP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |