C14H28N4 — CID 114213459
1-(3-ethyltriazol-4-yl)-N,3,5,5-tetramethylhexan-1-amine (PubChem CID 114213459) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-(3-ethyltriazol-4-yl)-N,3,5,5-tetramethylhexan-1-amine.
| Compound Name | 1-(3-ethyltriazol-4-yl)-N,3,5,5-tetramethylhexan-1-amine |
|---|---|
| PubChem CID | 114213459 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | 1-(3-ethyltriazol-4-yl)-N,3,5,5-tetramethylhexan-1-amine |
| SMILES | CCn1nncc1C(CC(C)CC(C)(C)C)NC |
| InChI | InChI=1S/C14H28N4/c1-7-18-13(10-16-17-18)12(15-6)8-11(2)9-14(3,4)5/h10-12,15H,7-9H2,1-6H3 |
| InChIKey | QUJUYOWNHAYYAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |