C13H25N3O — CID 114213613
1-(3-ethyltriazol-4-yl)-3,5,5-trimethylhexan-1-ol (PubChem CID 114213613) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(3-ethyltriazol-4-yl)-3,5,5-trimethylhexan-1-ol.
| Compound Name | 1-(3-ethyltriazol-4-yl)-3,5,5-trimethylhexan-1-ol |
|---|---|
| PubChem CID | 114213613 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-(3-ethyltriazol-4-yl)-3,5,5-trimethylhexan-1-ol |
| SMILES | CCn1nncc1C(O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C13H25N3O/c1-6-16-11(9-14-15-16)12(17)7-10(2)8-13(3,4)5/h9-10,12,17H,6-8H2,1-5H3 |
| InChIKey | SBILTAKTKCFHIQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |