C12H15IN4 — CID 114213558
1-(3-ethyltriazol-4-yl)-1-(3-iodophenyl)-N-methylmethanamine (PubChem CID 114213558) has the molecular formula C12H15IN4 and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-(3-ethyltriazol-4-yl)-1-(3-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(3-ethyltriazol-4-yl)-1-(3-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114213558 |
| Molecular Formula | C12H15IN4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(3-ethyltriazol-4-yl)-1-(3-iodophenyl)-N-methylmethanamine |
| SMILES | CCn1nncc1C(NC)c1cccc(I)c1 |
| InChI | InChI=1S/C12H15IN4/c1-3-17-11(8-15-16-17)12(14-2)9-5-4-6-10(13)7-9/h4-8,12,14H,3H2,1-2H3 |
| InChIKey | WEJIGJSMKPOWAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|