C10H10ClF3N2O3 — CID 114213751
methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxylate (PubChem CID 114213751) has the molecular formula C10H10ClF3N2O3 and a molecular weight of 298.65 g/mol. Its IUPAC name is methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxylate.
| Compound Name | methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114213751 |
| Molecular Formula | C10H10ClF3N2O3 |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(CCOCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C10H10ClF3N2O3/c1-18-9(17)6-4-15-7(16-8(6)11)2-3-19-5-10(12,13)14/h4H,2-3,5H2,1H3 |
| InChIKey | KJXLOGGCSXBAFK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|