C14H15BrClN3 — CID 114215414
N-[(3-bromophenyl)methyl]-5-(chloromethyl)-N,2-dimethylpyrimidin-4-amine (PubChem CID 114215414) has the molecular formula C14H15BrClN3 and a molecular weight of 340.65 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-5-(chloromethyl)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-5-(chloromethyl)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114215414 |
| Molecular Formula | C14H15BrClN3 |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-5-(chloromethyl)-N,2-dimethylpyrimidin-4-amine |
| SMILES | Cc1ncc(CCl)c(N(C)Cc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C14H15BrClN3/c1-10-17-8-12(7-16)14(18-10)19(2)9-11-4-3-5-13(15)6-11/h3-6,8H,7,9H2,1-2H3 |
| InChIKey | LGRXQKUCITWKGO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|