C11H17F3N4 — CID 114216052
N-methyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 114216052) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is N-methyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | N-methyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114216052 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-methyl-5-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CCCNCc1cncnc1N(C)CC(F)(F)F |
| InChI | InChI=1S/C11H17F3N4/c1-3-4-15-5-9-6-16-8-17-10(9)18(2)7-11(12,13)14/h6,8,15H,3-5,7H2,1-2H3 |
| InChIKey | BNRZUXTWULQJKC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|