C14H26F2N2O — CID 114216924
[1-(3,3-difluorocyclohexyl)-4-(oxolan-2-yl)butyl]hydrazine (PubChem CID 114216924) has the molecular formula C14H26F2N2O and a molecular weight of 276.37 g/mol. Its IUPAC name is [1-(3,3-difluorocyclohexyl)-4-(oxolan-2-yl)butyl]hydrazine.
| Compound Name | [1-(3,3-difluorocyclohexyl)-4-(oxolan-2-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 114216924 |
| Molecular Formula | C14H26F2N2O |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [1-(3,3-difluorocyclohexyl)-4-(oxolan-2-yl)butyl]hydrazine |
| SMILES | NNC(CCCC1CCCO1)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H26F2N2O/c15-14(16)8-2-4-11(10-14)13(18-17)7-1-5-12-6-3-9-19-12/h11-13,18H,1-10,17H2 |
| InChIKey | VQMDPWBUTKYCIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|