C14H19F3N2 — CID 114216956
[1-(3,3-difluorocyclopentyl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine (PubChem CID 114216956) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is [1-(3,3-difluorocyclopentyl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(3,3-difluorocyclopentyl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114216956 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [1-(3,3-difluorocyclopentyl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(F)cc1CC(NN)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H19F3N2/c1-9-2-3-12(15)6-11(9)7-13(19-18)10-4-5-14(16,17)8-10/h2-3,6,10,13,19H,4-5,7-8,18H2,1H3 |
| InChIKey | RJJPFABDRDPINT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|