C16H24F2N2 — CID 114216850
[1-(3,3-difluorocyclohexyl)-2-(2,5-dimethylphenyl)ethyl]hydrazine (PubChem CID 114216850) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is [1-(3,3-difluorocyclohexyl)-2-(2,5-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(3,3-difluorocyclohexyl)-2-(2,5-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114216850 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [1-(3,3-difluorocyclohexyl)-2-(2,5-dimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C)c(CC(NN)C2CCCC(F)(F)C2)c1 |
| InChI | InChI=1S/C16H24F2N2/c1-11-5-6-12(2)14(8-11)9-15(20-19)13-4-3-7-16(17,18)10-13/h5-6,8,13,15,20H,3-4,7,9-10,19H2,1-2H3 |
| InChIKey | FROJRPSKKQQQFY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|