C12H14F2N2S2 — CID 114217023
2-(3,3-difluorocyclohexyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 114217023) has the molecular formula C12H14F2N2S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(3,3-difluorocyclohexyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 114217023 |
| Molecular Formula | C12H14F2N2S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | FC1(F)CCCC(c2nc(=S)c3c([nH]2)CSC3)C1 |
| InChI | InChI=1S/C12H14F2N2S2/c13-12(14)3-1-2-7(4-12)10-15-9-6-18-5-8(9)11(17)16-10/h7H,1-6H2,(H,15,16,17) |
| InChIKey | DBGPTARRGSRMJB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|