C14H20N2S2 — CID 106481789
2-cyclooctyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481789) has the molecular formula C14H20N2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-cyclooctyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-cyclooctyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481789 |
| Molecular Formula | C14H20N2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-cyclooctyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(C2CCCCCCC2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C14H20N2S2/c17-14-11-8-18-9-12(11)15-13(16-14)10-6-4-2-1-3-5-7-10/h10H,1-9H2,(H,15,16,17) |
| InChIKey | MZUDZJROTFYQAI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|