C12H24N2O3 — CID 114218401
2-amino-1-(2-ethyl-1,4-oxazepan-4-yl)-4-methoxybutan-1-one (PubChem CID 114218401) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-amino-1-(2-ethyl-1,4-oxazepan-4-yl)-4-methoxybutan-1-one.
| Compound Name | 2-amino-1-(2-ethyl-1,4-oxazepan-4-yl)-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 114218401 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-amino-1-(2-ethyl-1,4-oxazepan-4-yl)-4-methoxybutan-1-one |
| SMILES | CCC1CN(C(=O)C(N)CCOC)CCCO1 |
| InChI | InChI=1S/C12H24N2O3/c1-3-10-9-14(6-4-7-17-10)12(15)11(13)5-8-16-2/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | PQGXTVTXWKYQGZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |