C13H26N2OS — CID 114218488
2-ethyl-4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane (PubChem CID 114218488) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is 2-ethyl-4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane.
| Compound Name | 2-ethyl-4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 114218488 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-ethyl-4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane |
| SMILES | CCC1CN(CCC2CSCCN2)CCCO1 |
| InChI | InChI=1S/C13H26N2OS/c1-2-13-10-15(6-3-8-16-13)7-4-12-11-17-9-5-14-12/h12-14H,2-11H2,1H3 |
| InChIKey | AGAQAIKJTJDRAZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |