C11H22N2OS — CID 66419967
4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane (PubChem CID 66419967) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane.
| Compound Name | 4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 66419967 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-(2-thiomorpholin-3-ylethyl)-1,4-oxazepane |
| SMILES | C1COCCN(CCC2CSCCN2)C1 |
| InChI | InChI=1S/C11H22N2OS/c1-4-13(6-8-14-7-1)5-2-11-10-15-9-3-12-11/h11-12H,1-10H2 |
| InChIKey | CWRZWMOHHUCWNV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |