C12H18N4S — CID 114222537
3-ethyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]triazol-4-amine (PubChem CID 114222537) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-ethyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]triazol-4-amine.
| Compound Name | 3-ethyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]triazol-4-amine |
|---|---|
| PubChem CID | 114222537 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-ethyl-N-[1-(5-methylthiophen-2-yl)propan-2-yl]triazol-4-amine |
| SMILES | CCn1nncc1NC(C)Cc1ccc(C)s1 |
| InChI | InChI=1S/C12H18N4S/c1-4-16-12(8-13-15-16)14-9(2)7-11-6-5-10(3)17-11/h5-6,8-9,14H,4,7H2,1-3H3 |
| InChIKey | POSRXOPKZLTTEW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |