C11H21N5O — CID 114222846
N,N-diethyl-2-[(3-propyltriazol-4-yl)amino]acetamide (PubChem CID 114222846) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N,N-diethyl-2-[(3-propyltriazol-4-yl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[(3-propyltriazol-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 114222846 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,N-diethyl-2-[(3-propyltriazol-4-yl)amino]acetamide |
| SMILES | CCCn1nncc1NCC(=O)N(CC)CC |
| InChI | InChI=1S/C11H21N5O/c1-4-7-16-10(8-13-14-16)12-9-11(17)15(5-2)6-3/h8,12H,4-7,9H2,1-3H3 |
| InChIKey | APSKWZOBHSGMDN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |