C9H19N5O2S — CID 114222897
N-ethyl-2-[(3-propyltriazol-4-yl)amino]ethanesulfonamide (PubChem CID 114222897) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-ethyl-2-[(3-propyltriazol-4-yl)amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(3-propyltriazol-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 114222897 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-ethyl-2-[(3-propyltriazol-4-yl)amino]ethanesulfonamide |
| SMILES | CCCn1nncc1NCCS(=O)(=O)NCC |
| InChI | InChI=1S/C9H19N5O2S/c1-3-6-14-9(8-11-13-14)10-5-7-17(15,16)12-4-2/h8,10,12H,3-7H2,1-2H3 |
| InChIKey | AAJOUDOBQKKIRZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |