C13H19N5 — CID 114223486
1-phenyl-N-(3-propyltriazol-4-yl)ethane-1,2-diamine (PubChem CID 114223486) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-phenyl-N-(3-propyltriazol-4-yl)ethane-1,2-diamine.
| Compound Name | 1-phenyl-N-(3-propyltriazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114223486 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 1-phenyl-N-(3-propyltriazol-4-yl)ethane-1,2-diamine |
| SMILES | CCCn1nncc1NC(CN)c1ccccc1 |
| InChI | InChI=1S/C13H19N5/c1-2-8-18-13(10-15-17-18)16-12(9-14)11-6-4-3-5-7-11/h3-7,10,12,16H,2,8-9,14H2,1H3 |
| InChIKey | OEJLLWAMGRYLRN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |