C12H23N5 — CID 114223495
N-[1-(aminomethyl)-3-methylcyclohexyl]-3-ethyltriazol-4-amine (PubChem CID 114223495) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3-methylcyclohexyl]-3-ethyltriazol-4-amine.
| Compound Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-3-ethyltriazol-4-amine |
|---|---|
| PubChem CID | 114223495 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-3-ethyltriazol-4-amine |
| SMILES | CCn1nncc1NC1(CN)CCCC(C)C1 |
| InChI | InChI=1S/C12H23N5/c1-3-17-11(8-14-16-17)15-12(9-13)6-4-5-10(2)7-12/h8,10,15H,3-7,9,13H2,1-2H3 |
| InChIKey | JTRPYLBQHIOLTR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |