C33H33F6N3O4 — CID 11422370
(2Z)-N-[4-(2-morpholin-4-ylethoxy)-3-(trifluoromethyl)phenyl]-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 11422370) has the molecular formula C33H33F6N3O4 and a molecular weight of 649.63 g/mol. Its IUPAC name is (2Z)-N-[4-(2-morpholin-4-ylethoxy)-3-(trifluoromethyl)phenyl]-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | (2Z)-N-[4-(2-morpholin-4-ylethoxy)-3-(trifluoromethyl)phenyl]-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 11422370 |
| Molecular Formula | C33H33F6N3O4 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | (2Z)-N-[4-(2-morpholin-4-ylethoxy)-3-(trifluoromethyl)phenyl]-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CC(C)c1ccc(/C=C(/C(=O)Nc2cccc(C(F)(F)F)c2)C(=O)Nc2ccc(OCCN3CCOCC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C33H33F6N3O4/c1-21(2)23-8-6-22(7-9-23)18-27(30(43)40-25-5-3-4-24(19-25)32(34,35)36)31(44)41-26-10-11-29(28(20-26)33(37,38)39)46-17-14-42-12-15-45-16-13-42/h3-11,18-21H,12-17H2,1-2H3,(H,40,43)(H,41,44)/b27-18- |
| InChIKey | AHLONJHUUCNWRE-IMRQLAEWSA-N |
| XLogP | 7.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|