C14H25F2NO — CID 114223810
[1-[(3,3-difluorocyclohexyl)methylamino]cyclohexyl]methanol (PubChem CID 114223810) has the molecular formula C14H25F2NO and a molecular weight of 261.36 g/mol. Its IUPAC name is [1-[(3,3-difluorocyclohexyl)methylamino]cyclohexyl]methanol.
| Compound Name | [1-[(3,3-difluorocyclohexyl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 114223810 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | [1-[(3,3-difluorocyclohexyl)methylamino]cyclohexyl]methanol |
| SMILES | OCC1(NCC2CCCC(F)(F)C2)CCCCC1 |
| InChI | InChI=1S/C14H25F2NO/c15-14(16)8-4-5-12(9-14)10-17-13(11-18)6-2-1-3-7-13/h12,17-18H,1-11H2 |
| InChIKey | PWJNHKAHDWDHBM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |