C12H20F2N2O — CID 114224136
N-[1-[(3,3-difluorocyclopentyl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine (PubChem CID 114224136) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is N-[1-[(3,3-difluorocyclopentyl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[1-[(3,3-difluorocyclopentyl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 114224136 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-[1-[(3,3-difluorocyclopentyl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CC1CN(CC2CCC(F)(F)C2)CCC1=NO |
| InChI | InChI=1S/C12H20F2N2O/c1-9-7-16(5-3-11(9)15-17)8-10-2-4-12(13,14)6-10/h9-10,17H,2-8H2,1H3 |
| InChIKey | ZXTWXLNLMROHKN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|