C15H19FN2O2 — CID 114501083
(NE)-N-[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine (PubChem CID 114501083) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is (NE)-N-[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 114501083 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (NE)-N-[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-methylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CC1CN(CC2Cc3cc(F)ccc3O2)CC/C1=N\O |
| InChI | InChI=1S/C15H19FN2O2/c1-10-8-18(5-4-14(10)17-19)9-13-7-11-6-12(16)2-3-15(11)20-13/h2-3,6,10,13,19H,4-5,7-9H2,1H3/b17-14+ |
| InChIKey | NKRTVJXVPSJAPE-SAPNQHFASA-N |
| XLogP | 2.30 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|