C13H20F2N2O — CID 114224525
2-(3,3-difluorocyclohexyl)-1-(1,3-dimethylpyrazol-4-yl)ethanol (PubChem CID 114224525) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(1,3-dimethylpyrazol-4-yl)ethanol.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(1,3-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 114224525 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(1,3-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)cc1C(O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H20F2N2O/c1-9-11(8-17(2)16-9)12(18)6-10-4-3-5-13(14,15)7-10/h8,10,12,18H,3-7H2,1-2H3 |
| InChIKey | XWTBEKFWUGEXCU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |